What is the molecular formula of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The molecular formula is C12H30O3Si2.
What is the molecular weight of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The molecular weight is 278.53 g/mol.
What is the IUPAC name of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The IUPAC name is 4-[[4-hydroxybutyl(dimethyl)silyl]oxy-dimethylsilyl]butan-1-ol.
What is the InChI of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The InChI is InChI=1S/C12H30O3Si2/c1-16(2,11-7-5-9-13)15-17(3,4)12-8-6-10-14/h13-14H,5-12H2,1-4H3.
What is the InChIKey of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The InChIKey is OWJKJLOCIDNNGJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The canonical SMILES is C[Si](C)(CCCCO)O[Si](C)(C)CCCCO.
What is the CAS number of 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane?
The CAS number is 5931-17-9.
How many hydrogen bond donor count does 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane have?
It has 2 hydrogen bond donors.
How many hydrogen bond acceptor count does 1,3-Bis(4-hydroxybutyl)tetramethyldisiloxane have?
It has 3 hydrogen bond acceptors.