Aciclovir sodium

CAS

69657-51-8

Catalog Number

ACM69657518

Category

Other Products

Molecular Weight

247.19

Molecular Formula

C₈H₁₀N₅NaO₃

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

1,9-dihydro-2-amino-9-((2-hydroxyethoxy)methyl)-6h-purin-6-onmonosodiumsa;2-amino-1,9-dihydro-9-((2-hydroxyethoxy)methyl)-6h-purin-6-onemonosodiumsal;acycloguanosinesodium(obs.);acyclovirsodiumsalt;sodiumacyclovir;zovirax;zoviraxsodium;ACYCLOVIR SODIUM

What is the molecular formula of Aciclovir sodium?

The molecular formula of Aciclovir sodium is C8H10N5NaO3.

What is the molecular weight of Aciclovir sodium?

The molecular weight of Aciclovir sodium is 247.19 g/mol.

What is the IUPAC name of Aciclovir sodium?

The IUPAC name of Aciclovir sodium is sodium;2-amino-9-(2-hydroxyethoxymethyl)purin-6-olate.

What is the InChIKey of Aciclovir sodium?

The InChIKey of Aciclovir sodium is RMLUKZWYIKEASN-UHFFFAOYSA-M.

What is the canonical SMILES representation of Aciclovir sodium?

The canonical SMILES representation of Aciclovir sodium is C1=NC2=C(N1COCCO)N=C(N=C2[O-])N.[Na+].

What are some synonyms for Aciclovir sodium?

Some synonyms for Aciclovir sodium include ACYCLOVIR SODIUM, Sodium acyclovir, and Acyclovir sodium salt.

What is the CAS number for Aciclovir sodium?

The CAS number for Aciclovir sodium is 69657-51-8.

How does Aciclovir sodium work as an antiviral medication?

Aciclovir sodium converts in vivo to the active metabolite acyclovir triphosphate, which competitively inhibits viral DNA polymerase by incorporating into the growing viral DNA chain and terminating further polymerization.

What types of viral infections is Aciclovir sodium approved to treat or prevent?

Aciclovir sodium is approved to treat and/or prevent certain types of herpes simplex virus (HSV) infections, varicella zoster virus (VZV) infections, and other viruses of the herpesvirus family.

What populations are specific formulations and strengths of Aciclovir sodium approved for use in?

Specific formulations and strengths of Aciclovir sodium are approved for use in specific populations, including people who are immunocompromised and those with HIV who may develop opportunistic infections (OIs) related to HSV and VZV.