What is the molecular formula of the compound with PubChem CID 12947115?
The molecular formula is C9H10N2O2.
What are the synonyms for the compound with PubChem CID 12947115?
The synonyms include 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one, 82673-70-9, and DTXSID30513613.
What is the molecular weight of the compound with PubChem CID 12947115?
The molecular weight is 178.19 g/mol.
When was the compound with PubChem CID 12947115 created and last modified?
It was created on February 8, 2007, and last modified on November 25, 2023.
What is the IUPAC name of the compound with PubChem CID 12947115?
The IUPAC name is 5-methoxy-3,4-dihydro-1H-1,7-naphthyridin-2-one.
What is the InChI code for the compound with PubChem CID 12947115?
The InChI code is InChI=1S/C9H10N2O2/c1-13-8-5-10-4-7-6(8)2-3-9(12)11-7/h4-5H,2-3H2,1H3,(H,11,12).
What is the InChIKey for the compound with PubChem CID 12947115?
The InChIKey is BQHIKANMZYIMTG-UHFFFAOYSA-N.
What is the Canonical SMILES for the compound with PubChem CID 12947115?
The Canonical SMILES is COC1=C2CCC(=O)NC2=CN=C1.
How many hydrogen bond donor counts does the compound with PubChem CID 12947115 have?
It has 1 hydrogen bond donor count.
Is the compound with PubChem CID 12947115 canonicalized?
Yes, the compound is canonicalized.
What is the molecular formula of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
The molecular formula is C9H10N2O2.
When was 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one created and modified according to PubChem CID 12947115?
It was created on 2007-02-08 and modified on 2023-11-25.
What is the IUPAC name of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
The IUPAC name is 5-methoxy-3,4-dihydro-1H-1,7-naphthyridin-2-one.
What is the InChIKey of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
The InChIKey is BQHIKANMZYIMTG-UHFFFAOYSA-N.
How many hydrogen bond donor counts are there in 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
There is 1 hydrogen bond donor count.
What is the exact mass of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
The exact mass is 178.074227566 g/mol.
What is the topological polar surface area of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
The topological polar surface area is 51.2 Ų.
How many heavy atoms are present in the structure of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
There are 13 heavy atoms.
Is 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one a canonicalized compound?
Yes, it is a canonicalized compound.
How many rotatable bonds are there in the structure of 5-Methoxy-3,4-dihydro-1,7-naphthyridin-2(1H)-one?
There is 1 rotatable bond.