5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde

• CAS: 1246088-60-7
• Catalog Number: ACM1246088607
• Category: Aryl
• Molecular Weight: 164.14
• Hazard Statements: H225-H304-H315-H336-H410
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The molecular formula is C8H5FN2O.

What is the molecular weight of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The molecular weight is 164.14 g/mol.

What is the IUPAC name of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The IUPAC name is 5-fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde.

What is the InChI of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The InChI is: InChI=1S/C8H5FN2O/c9-6-3-5-1-2-10-8(5)11-7(6)4-12/h1-4H,(H,10,11).

What is the InChIKey of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The InChIKey is DNYPXIDCAJUCTO-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The canonical SMILES is C1=CNC2=NC(=C(C=C21)F)C=O.

What is the CAS number of 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde?

The CAS number is 1246088-60-7.

How many hydrogen bond donor counts does 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-6-carbaldehyde have?

It has 3 hydrogen bond acceptor counts.