5-Chlorobenzofuran-3-one

• CAS: 3261-05-0
• Catalog Number: ACM3261050-1
• Category: Furans
• Molecular Weight: 168.58
• Molecular Formula: C8H5ClO2
• Appearance: Orange solid

Custom Q&A

What is the molecular formula of 5-Chlorobenzofuran-3-one?

The molecular formula of 5-Chlorobenzofuran-3-one is C8H5ClO2.

When was 5-Chlorobenzofuran-3-one first created?

5-Chlorobenzofuran-3-one was first created on 2005-09-10.

How is the IUPAC name of 5-Chlorobenzofuran-3-one computed?

The IUPAC name of 5-Chlorobenzofuran-3-one is computed by Lexichem TK 2.7.0.

What is the Canonical SMILES of 5-Chlorobenzofuran-3-one?

The Canonical SMILES of 5-Chlorobenzofuran-3-one is C1C(=O)C2=C(O1)C=CC(=C2)Cl.

What is the molecular weight of 5-Chlorobenzofuran-3-one?

The molecular weight of 5-Chlorobenzofuran-3-one is 168.57 g/mol.

How many hydrogen bond donor counts does 5-Chlorobenzofuran-3-one have?

5-Chlorobenzofuran-3-one has 0 hydrogen bond donor counts.

What is the exact mass of 5-Chlorobenzofuran-3-one?

The exact mass of 5-Chlorobenzofuran-3-one is 167.9978071 g/mol.

What is the topological polar surface area of 5-Chlorobenzofuran-3-one?

The topological polar surface area of 5-Chlorobenzofuran-3-one is 26.3 Ų.

How many heavy atoms are present in 5-Chlorobenzofuran-3-one?

There are 11 heavy atoms in 5-Chlorobenzofuran-3-one.

Is 5-Chlorobenzofuran-3-one a canonicalized compound?

Yes, 5-Chlorobenzofuran-3-one is a canonicalized compound.