5-Bromo-1,3-dichloro-2-fluorobenzene

• CAS: 17318-08-0
• Catalog Number: ACM17318080
• Category: Bromine Series
• Molecular Formula: C₆H₂BrCl₂F

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C6H2BrCl2F.

What is the molecular weight of the compound?

The molecular weight is 243.88 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 5-bromo-1,3-dichloro-2-fluorobenzene.

What is the InChI of the compound?

The InChI is InChI=1S/C6H2BrCl2F/c7-3-1-4(8)6(10)5(9)2-3/h1-2H.

What is the InChIKey of the compound?

The InChIKey is MMJSIYGLDQNUTH-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=C(C=C(C(=C1Cl)F)Cl)Br.

What is the CAS number of the compound?

The CAS number is 17318-08-0.

What is the European Community (EC) number of the compound?

The EC number is 640-454-2.

What is the Monoisotopic Mass of the compound?

The Monoisotopic Mass is 241.87010 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.