4-Cyano-2-fluorophenylboronic acid, pinacol ester

• CAS: 1035235-29-0
• Catalog Number: ACM1035235290-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The molecular formula is C13H15BFNO2.

What is the molecular weight of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The molecular weight is 247.07 g/mol.

What is the IUPAC name of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The IUPAC name is 3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.

What is the InChI of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The InChI is InChI=1S/C13H15BFNO2/c1-12(2)13(3,4)18-14(17-12)10-6-5-9(8-16)7-11(10)15/h5-7H,1-4H3.

What is the InChIKey of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The InChIKey is FEUINZSEHIJUBU-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C#N)F.

What is the CAS number of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The CAS number is 1035235-29-0.

What is the European Community (EC) number of 4-Cyano-2-fluorophenylboronic acid, pinacol ester?

The EC number is 690-897-0.

Is 4-Cyano-2-fluorophenylboronic acid, pinacol ester a covalently-bonded unit?

Yes, it has a covalently-bonded unit count of 1.