What is the molecular formula of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The molecular formula is C6H2Cl2N2O3S.
What is the molecular weight of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The molecular weight is 253.06 g/mol.
What is the IUPAC name of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The IUPAC name is 4-chloro-2,1,3-benzoxadiazole-7-sulfonyl chloride.
What is the InChI of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The InChI is InChI=1S/C6H2Cl2N2O3S/c7-3-1-2-4(14(8,11)12)6-5(3)9-13-10-6/h1-2H.
What is the InChIKey of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The InChIKey is BPPRLMZEVZSIIJ-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The canonical SMILES is C1=C(C2=NON=C2C(=C1)Cl)S(=O)(=O)Cl.
What is the CAS number of 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole?
The CAS number is 142246-48-8.
How many hydrogen bond acceptors does 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole have?
It has 5 hydrogen bond acceptors.
How many rotatable bonds does 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole have?
It has 1 rotatable bond.
Is 4-Chloro-7-chlorosulfonyl-2,1,3-benzoxadiazole a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.