CAS
20099-89-2 Purity
---
20099-89-2 Purity
---
Inquiry Basket
4-Bromo-5-chloro-2-fluorotoluene
CAS
201849-17-4
Catalog Number
ACM201849174
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-5-chloro-2-fluorotoluene?
The molecular formula of 4-Bromo-5-chloro-2-fluorotoluene is C7H5BrClF.
What are the synonyms for 4-Bromo-5-chloro-2-fluorotoluene?
The synonyms for 4-Bromo-5-chloro-2-fluorotoluene are 1-bromo-2-chloro-5-fluoro-4-methylbenzene and Benzene, 1-bromo-2-chloro-5-fluoro-4-methyl.
What is the molecular weight of 4-Bromo-5-chloro-2-fluorotoluene?
The molecular weight of 4-Bromo-5-chloro-2-fluorotoluene is 223.47 g/mol.
What is the IUPAC name of 4-Bromo-5-chloro-2-fluorotoluene?
The IUPAC name of 4-Bromo-5-chloro-2-fluorotoluene is 1-bromo-2-chloro-5-fluoro-4-methylbenzene.
What is the InChI of 4-Bromo-5-chloro-2-fluorotoluene?
The InChI of 4-Bromo-5-chloro-2-fluorotoluene is InChI=1S/C7H5BrClF/c1-4-2-6(9)5(8)3-7(4)10/h2-3H,1H3.
What is the InChIKey of 4-Bromo-5-chloro-2-fluorotoluene?
The InChIKey of 4-Bromo-5-chloro-2-fluorotoluene is KKCFZSZRHRVSRA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-5-chloro-2-fluorotoluene?
The canonical SMILES of 4-Bromo-5-chloro-2-fluorotoluene is CC1=CC(=C(C=C1F)Br)Cl.
What is the XLogP3-AA value of 4-Bromo-5-chloro-2-fluorotoluene?
The XLogP3-AA value of 4-Bromo-5-chloro-2-fluorotoluene is 3.7.
How many hydrogen bond donor counts does 4-Bromo-5-chloro-2-fluorotoluene have?
4-Bromo-5-chloro-2-fluorotoluene has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Bromo-5-chloro-2-fluorotoluene have?
4-Bromo-5-chloro-2-fluorotoluene has 1 hydrogen bond acceptor count.
Recommended Products
