4-Bromo-2-morpholinobenzoic acid

• CAS: 1099687-03-2
• Catalog Number: ACM1099687032
• Category: Bromine Series
• Molecular Formula: C₁₁H₁₂BrNO₃

Custom Q&A

What is the molecular formula of 4-Bromo-2-morpholinobenzoic acid?

The molecular formula of 4-Bromo-2-morpholinobenzoic acid is C11H12BrNO3.

What is the molecular weight of 4-Bromo-2-morpholinobenzoic acid?

The molecular weight of 4-Bromo-2-morpholinobenzoic acid is 286.12 g/mol.

What is the IUPAC name of 4-Bromo-2-morpholinobenzoic acid?

The IUPAC name of 4-Bromo-2-morpholinobenzoic acid is 4-bromo-2-morpholin-4-ylbenzoic acid.

What is the InChI of 4-Bromo-2-morpholinobenzoic acid?

The InChI of 4-Bromo-2-morpholinobenzoic acid is InChI=1S/C11H12BrNO3/c12-8-1-2-9(11(14)15)10(7-8)13-3-5-16-6-4-13/h1-2,7H,3-6H2,(H,14,15).

What is the InChIKey of 4-Bromo-2-morpholinobenzoic acid?

The InChIKey of 4-Bromo-2-morpholinobenzoic acid is FYELNCRQYNFNFO-UHFFFAOYSA-N.

What is the canonical SMILES of 4-Bromo-2-morpholinobenzoic acid?

The canonical SMILES of 4-Bromo-2-morpholinobenzoic acid is C1COCCN1C2=C(C=CC(=C2)Br)C(=O)O.

What is the CAS number of 4-Bromo-2-morpholinobenzoic acid?

The CAS number of 4-Bromo-2-morpholinobenzoic acid is 1099687-03-2.

What is the DSSTox Substance ID of 4-Bromo-2-morpholinobenzoic acid?

The DSSTox Substance ID of 4-Bromo-2-morpholinobenzoic acid is DTXSID30655926.

Is 4-Bromo-2-morpholinobenzoic acid a canonicalized compound?

Yes, 4-Bromo-2-morpholinobenzoic acid is a canonicalized compound.