CAS
53101-02-3 Purity
---
53101-02-3 Purity
---
Inquiry Basket
4-Bromo-2-chloro-5-fluorotoluene
CAS
93765-83-4
Catalog Number
ACM93765834
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-2-chloro-5-fluorotoluene?
The molecular formula of 4-Bromo-2-chloro-5-fluorotoluene is C7H5BrClF.
What is the molecular weight of 4-Bromo-2-chloro-5-fluorotoluene?
The molecular weight of 4-Bromo-2-chloro-5-fluorotoluene is 223.47 g/mol.
What is the IUPAC name of 4-Bromo-2-chloro-5-fluorotoluene?
The IUPAC name of 4-Bromo-2-chloro-5-fluorotoluene is 1-bromo-5-chloro-2-fluoro-4-methylbenzene.
What is the InChI of 4-Bromo-2-chloro-5-fluorotoluene?
The InChI of 4-Bromo-2-chloro-5-fluorotoluene is InChI=1S/C7H5BrClF/c1-4-2-7(10)5(8)3-6(4)9/h2-3H,1H3.
What is the InChIKey of 4-Bromo-2-chloro-5-fluorotoluene?
The InChIKey of 4-Bromo-2-chloro-5-fluorotoluene is GYFUSHKOOPPODA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-2-chloro-5-fluorotoluene?
The canonical SMILES of 4-Bromo-2-chloro-5-fluorotoluene is CC1=CC(=C(C=C1Cl)Br)F.
What is the CAS number of 4-Bromo-2-chloro-5-fluorotoluene?
The CAS number of 4-Bromo-2-chloro-5-fluorotoluene is 93765-83-4.
What is the XLogP3-AA value of 4-Bromo-2-chloro-5-fluorotoluene?
The XLogP3-AA value of 4-Bromo-2-chloro-5-fluorotoluene is 3.7.
How many hydrogen bond acceptor counts does 4-Bromo-2-chloro-5-fluorotoluene have?
4-Bromo-2-chloro-5-fluorotoluene has 1 hydrogen bond acceptor count.
How many rotatable bond counts does 4-Bromo-2-chloro-5-fluorotoluene have?
4-Bromo-2-chloro-5-fluorotoluene has 0 rotatable bond counts.
Recommended Products
