CAS
1451393-52-4 Purity
---
1451393-52-4 Purity
---
Inquiry Basket
4-Bromo-2,5-dimethoxyphenylboronic acid
CAS
950846-26-1
Catalog Number
ACM950846261
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The molecular formula of 4-Bromo-2,5-dimethoxyphenylboronic acid is C8H10BBrO4.
What is the molecular weight of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The molecular weight of 4-Bromo-2,5-dimethoxyphenylboronic acid is 260.88 g/mol.
When was 4-Bromo-2,5-dimethoxyphenylboronic acid created?
4-Bromo-2,5-dimethoxyphenylboronic acid was created on December 5, 2007.
What is the IUPAC name of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The IUPAC name of 4-Bromo-2,5-dimethoxyphenylboronic acid is (4-bromo-2,5-dimethoxyphenyl)boronic acid.
What is the InChI key of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The InChI key of 4-Bromo-2,5-dimethoxyphenylboronic acid is VFSKPPVNGHKIFE-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Bromo-6,5-dimethoxyphenylboronic acid?
The canonical SMILES of 4-Bromo-2,5-dimethoxyphenylboronic acid is B(C1=CC(=C(C=C1OC)Br)OC)(O)O.
What is the CAS number of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The CAS number of 4-Bromo-2,5-dimethoxyphenylboronic acid is 950846-26-1.
How many hydrogen bond donor counts does 4-Bromo-2,5-dimethoxyphenylboronic acid have?
4-Bromo-2,5-dimethoxyphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 4-Bromo-2,5-dimethoxyphenylboronic acid have?
4-Bromo-2,5-dimethoxyphenylboronic acid has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-Bromo-2,5-dimethoxyphenylboronic acid?
The topological polar surface area of 4-Bromo-2,5-dimethoxyphenylboronic acid is 58.9Ų.
Recommended Products
CAS
1451393-59-1 Purity
---
1451393-59-1 Purity
---
