120-74-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C27H26N2O2.
The molecular weight of the compound is 410.5 g/mol.
The IUPAC name of the compound is 4-[4-[2-[4-(4-aminophenoxy)phenyl]propan-2-yl]phenoxy]aniline.
The InChI of the compound is InChI=1S/C27H26N2O2/c1-27(2,19-3-11-23(12-4-19)30-25-15-7-21(28)8-16-25)20-5-13-24(14-6-20)31-26-17-9-22(29)10-18-26/h3-18H,28-29H2,1-2H3.
The InChIKey of the compound is KMKWGXGSGPYISJ-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(C)(C1=CC=C(C=C1)OC2=CC=C(C=C2)N)C3=CC=C(C=C3)OC4=CC=C(C=C4)N.
The CAS number of the compound is 13080-86-9.
The XLogP3-AA value of the compound is 6.4.
The compound has 2 hydrogen bond donor counts.
The compound has 4 hydrogen bond acceptor counts.