3-Methylpyrazine-2-carboxylicacid

• CAS: 41110-28-5
• Catalog Number: ACM41110285
• Category: Pyrazines
• Molecular Weight: 138.1
• Molecular Formula: C6H6N2O2
• Appearance: White Powder

Custom Q&A

What is the molecular formula of 3-Methylpyrazine-2-carboxylic acid?

The molecular formula of 3-Methylpyrazine-2-carboxylic acid is C6H6N2O2.

How is 3-Methylpyrazine-2-carboxylic acid represented in InChI?

3-Methylpyrazine-2-carboxylic acid is represented in InChI as InChI=1S/C6H6N2O2/c1-4-5(6(9)10)8-3-2-7-4/h2-3H,1H3,(H,9,10).

What is the exact mass of 3-Methylpyrazine-2-carboxylic acid?

The exact mass of 3-Methylpyrazine-2-carboxylic acid is 138.042927438 g/mol.

How many hydrogen bond donor counts does 3-Methylpyrazine-2-carboxylic acid have?

3-Methylpyrazine-2-carboxylic acid has 1 hydrogen bond donor count.

What is the topological polar surface area of 3-Methylpyrazine-2-carboxylic acid?

The topological polar surface area of 3-Methylpyrazine-2-carboxylic acid is 63.1?2.

Is 3-Methylpyrazine-2-carboxylic acid a canonical compound?

Yes, 3-Methylpyrazine-2-carboxylic acid is considered a canonical compound.

What is the molecular weight of 3-Methylpyrazine-2-carboxylic acid?

The molecular weight of 3-Methylpyrazine-2-carboxylic acid is 138.12 g/mol.

How many heavy atoms are present in the structure of 3-Methylpyrazine-2-carboxylic acid?

There are 10 heavy atoms in the structure of 3-Methylpyrazine-2-carboxylic acid.

Does 3-Methylpyrazine-2-carboxylic acid have any defined atom stereocenter counts?

No, 3-Methylpyrazine-2-carboxylic acid does not have any defined atom stereocenter counts.

What is the formal charge of 3-Methylpyrazine-2-carboxylic acid?

The formal charge of 3-Methylpyrazine-2-carboxylic acid is 0.