CAS
106-53-6 Purity
---
106-53-6 Purity
---
Inquiry Basket
3-Bromo-5-chloro-2-hydroxypyridine
CAS
137628-16-1
Catalog Number
ACM137628161
Category
Bromine Series
Molecular Weight
208.44
Molecular Formula
C5H3BrClNO
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-chloro-2-hydroxypyridine?
The molecular formula of 3-Bromo-5-chloro-2-hydroxypyridine is C5H3BrClNO.
What is the molecular weight of 3-Bromo-5-chloro-2-hydroxypyridine?
The molecular weight of 3-Bromo-5-chloro-2-hydroxypyridine is 208.44 g/mol.
What is the IUPAC name of 3-Bromo-5-chloro-2-hydroxypyridine?
The IUPAC name of 3-Bromo-5-chloro-2-hydroxypyridine is 3-bromo-5-chloro-1H-pyridin-2-one.
What is the InChI of 3-Bromo-5-chloro-2-hydroxypyridine?
The InChI of 3-Bromo-5-chloro-2-hydroxypyridine is InChI=1S/C5H3BrClNO/c6-4-1-3(7)2-8-5(4)9/h1-2H,(H,8,9).
What is the InChIKey of 3-Bromo-5-chloro-2-hydroxypyridine?
The InChIKey of 3-Bromo-5-chloro-2-hydroxypyridine is IPCVJZRBMDESEV-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-chloro-2-hydroxypyridine?
The canonical SMILES of 3-Bromo-5-chloro-2-hydroxypyridine is C1=C(C(=O)NC=C1Cl)Br.
What is the CAS number of 3-Bromo-5-chloro-2-hydroxypyridine?
The CAS number of 3-Bromo-5-chloro-2-hydroxypyridine is 137628-16-1.
How many hydrogen bond donor counts does 3-Bromo-5-chloro-2-hydroxypyridine have?
3-Bromo-5-chloro-2-hydroxypyridine has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 3-Bromo-5-chloro-2-hydroxypyridine have?
3-Bromo-5-chloro-2-hydroxypyridine has 1 hydrogen bond acceptor count.
Recommended Products
