3,3-Difluorocyclopentan-1-amine

• CAS: 939398-48-8
• Catalog Number: ACM939398488
• Category: Other Products
• Molecular Weight: 157.589406 [g/mol]
• Molecular Formula: C₅H₉F₂N.HCL
• Synonyms: 3,3-DIFLUOROCYCLOPENTANAMINE HYDROCHLORIDE, 3,3-DIFLUOROCYCLOPENTANAMINE HCL, 3,3-difluorocyclopentan-1-amine hydrochloride, 939398-48-8, 939525-61-8, SureCN758317, MolPort-020-002-709, AKOS016011498, MCULE-2855930331, PB25527, YF10065, AK-90170, KB-233876, 3,3-difluoro-1-cyclopentanamine hydrochloride, A844742, M112262, 3,3-bis(fluoranyl)cyclopentan-1-amine hydrochloride
• IUPAC Name: 3,3-difluorocyclopentan-1-amine;hydrochloride
• Canonical SMILES: C1CC(CC1N)(F)F.Cl
• InChI Key: IIUHMNFTPGBLCX-UHFFFAOYSA-N
• Exact Mass: 157.04700
• H-Bond Acceptor: 3
• H-Bond Donor: 2

Custom Q&A

What is the molecular formula of 3,3-Difluorocyclopentan-1-amine?

The molecular formula of 3,3-Difluorocyclopentan-1-amine is C5H9F2N.

When was 3,3-Difluorocyclopentan-1-amine created?

3,3-Difluorocyclopentan-1-amine was created on August 5, 2011.

What is the IUPAC name of 3,3-Difluorocyclopentan-1-amine?

The IUPAC name of 3,3-Difluorocyclopentan-1-amine is 3,3-difluorocyclopentan-1-amine.

What is the InChIKey of 3,3-Difluorocyclopentan-1-amine?

The InChIKey of 3,3-Difluorocyclopentan-1-amine is QLOHXGYAULHFOG-UHFFFAOYSA-N.

What is the canonical SMILES of 3,3-Difluorocyclopentan-1-amine?

The canonical SMILES of 3,3-Difluorocyclopentan-1-amine is C1CC(CC1N)(F)F.

What is the molecular weight of 3,3-Difluorocyclopentan-1-amine?

The molecular weight of 3,3-Difluorocyclopentan-1-amine is 121.13 g/mol.

What is the XLogP3-AA value of 3,3-Difluorocyclopentan-1-amine?

The XLogP3-AA value of 3,3-Difluorocyclopentan-1-amine is 0.9.

How many hydrogen bond donor counts are there in 3,3-Difluorocyclopentan-1-amine?

There is 1 hydrogen bond donor count in 3,3-Difluorocyclopentan-1-amine.

How many hydrogen bond acceptor counts are there in 3,3-Difluorocyclopentan-1-amine?

There are 3 hydrogen bond acceptor counts in 3,3-Difluorocyclopentan-1-amine.

How many rotatable bond counts are there in 3,3-Difluorocyclopentan-1-amine?

There are 0 rotatable bond counts in 3,3-Difluorocyclopentan-1-amine.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3,3-difluorocyclopentan-1-amine.

What is the molecular formula of the compound?

The molecular formula of the compound is C5H9F2N.

What is the molecular weight of the compound?

The molecular weight of the compound is 121.13 g/mol.

When was the compound created?

The compound was created on August 5, 2011.

When was the compound last modified?

The compound was last modified on December 30, 2023.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C5H9F2N/c6-5(7)2-1-4(8)3-5/h4H,1-3,8H2.

What is the InChIKey of the compound?

The InChIKey of the compound is QLOHXGYAULHFOG-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1CC(CC1N)(F)F.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 0.9.

How many hydrogen bond acceptors does the compound have?

The compound has 3 hydrogen bond acceptors.