What is the molecular formula of 2-Methylphenylacetaldehyde dimethyl acetal?
The molecular formula is C11H16O2.
What is the molecular weight of 2-Methylphenylacetaldehyde dimethyl acetal?
The molecular weight is 180.24 g/mol.
What is the IUPAC name of 2-Methylphenylacetaldehyde dimethyl acetal?
The IUPAC name is 1-(2,2-dimethoxyethyl)-2-methylbenzene.
What is the InChI of 2-Methylphenylacetaldehyde dimethyl acetal?
The InChI is InChI=1S/C11H16O2/c1-9-6-4-5-7-10(9)8-11(12-2)13-3/h4-7,11H,8H2,1-3H3.
What is the InChIKey of 2-Methylphenylacetaldehyde dimethyl acetal?
The InChIKey is LQXUNLBAEJOILA-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Methylphenylacetaldehyde dimethyl acetal?
The Canonical SMILES is CC1=CC=CC=C1CC(OC)OC.
What is the CAS number of 2-Methylphenylacetaldehyde dimethyl acetal?
The CAS number is 134769-79-2.
What is the European Community (EC) number of 2-Methylphenylacetaldehyde dimethyl acetal?
The European Community (EC) number is 693-809-9.
What is the XLogP3 value of 2-Methylphenylacetaldehyde dimethyl acetal?
The XLogP3 value is 2.9.
Is 2-Methylphenylacetaldehyde dimethyl acetal a canonicalized compound?
Yes, it is a canonicalized compound according to PubChem.