2-Fluoro-N-methyl-4-nitrobenzamide

• CAS: 915087-24-0
• Catalog Number: ACM915087240
• Category: Other Products
• Molecular Weight: 0
• Molecular Formula: C₈H₇FN₂O₃
• Synonyms: 2-FLUORO-N-METHYL-4-NITROBENZAMIDE;N-Methyl-2-fluoro-4-nitrobenzamide;BenzaMide, 2-fluoro-N-Methyl-4-nitro-;1. 2-fluoro-N-Methyl-4-nitrobenzaMide;4-Nitro-2-fluoro-N-MethylbenzaMide
• Density: 1.358

Custom Q&A

What is the molecular formula of 2-Fluoro-N-methyl-4-nitrobenzamide?

The molecular formula is C8H7FN2O3.

What is the molecular weight of 2-Fluoro-N-methyl-4-nitrobenzamide?

The molecular weight is 198.15 g/mol.

What is the IUPAC name of 2-Fluoro-N-methyl-4-nitrobenzamide?

The IUPAC name is 2-fluoro-N-methyl-4-nitrobenzamide.

What is the InChI of 2-Fluoro-N-methyl-4-nitrobenzamide?

The InChI is InChI=1S/C8H7FN2O3/c1-10-8(12)6-3-2-5(11(13)14)4-7(6)9/h2-4H,1H3,(H,10,12).

What is the InChIKey of 2-Fluoro-N-methyl-4-nitrobenzamide?

The InChIKey is CWGRZEVFBBAKCD-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Fluoro-N-methyl-4-nitrobenzamide?

The canonical SMILES is CNC(=O)C1=C(C=C(C=C1)[N+](=O)[O-])F.

What is the CAS number of 2-Fluoro-N-methyl-4-nitrobenzamide?

The CAS number is 915087-24-0.

What is the hydrogen bond donor count of 2-Fluoro-N-methyl-4-nitrobenzamide?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 2-Fluoro-N-methyl-4-nitrobenzamide?

The hydrogen bond acceptor count is 4.

Is 2-Fluoro-N-methyl-4-nitrobenzamide a canonicalized compound?

Yes, it is a canonicalized compound.