2-Fluoro-3-methoxyphenylboronic acid pinacol ester

CAS

1165936-00-4

Catalog Number

ACM1165936004-1

Category

Boronic Esters

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The molecular formula of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is C13H18BFO3.

What are the synonyms for 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The synonyms for 2-Fluoro-3-methoxyphenylboronic acid pinacol ester include 1165936-00-4, 2-(2-Fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-Fluoro-3-methoxyphenylboronic acid pinacol ester, and 1,3,2-DIOXABOROLANE, 2-(2-FLUORO-3-METHOXYPHENYL)-4,4,5,5-TETRAMETHYL.

What is the molecular weight of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The molecular weight of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is 252.09 g/mol.

When was 2-Fluoro-3-methoxyphenylboronic acid pinacol ester created?

2-Fluoro-3-methoxyphenylboronic acid pinacol ester was created on June 21, 2011.

What is the IUPAC name of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The IUPAC name of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is 2-(2-fluoro-3-methoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.

What is the InChI of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The InChI of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is InChI=1S/C13H18BFO3/c1-12(2)13(3,4)18-14(17-12)9-7-6-8-10(16-5)11(9)15/h6-8H,1-5H3.

What is the InChIKey of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The InChIKey of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is MALXDJBHSGDLGF-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The canonical SMILES of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)OC)F.

What is the CAS number of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The CAS number of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is 1165936-00-4.

What is the hydrogen bond donor count of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester?

The hydrogen bond donor count of 2-Fluoro-3-methoxyphenylboronic acid pinacol ester is 0.

Recommended Products