(2-Bromo-ethyl)-carbamic acid benzyl ester

• CAS: 53844-02-3
• Catalog Number: ACM53844023
• Category: Bromine Series
• Molecular Formula: C₁₀H₁₂BrNO₂
• Synonyms: Benzyl N-(2-bromoethyl)carbamate;(2-Bromo-ethyl)-carbamic acid benzyl ester

Custom Q&A

What is the molecular formula of (2-Bromo-ethyl)-carbamic acid benzyl ester?

The molecular formula is C10H12BrNO2.

What is the molecular weight of (2-Bromo-ethyl)-carbamic acid benzyl ester?

The molecular weight is 258.11 g/mol.

What is the IUPAC name of (2-Bromo-ethyl)-carbamic acid benzyl ester?

The IUPAC name is benzyl N-(2-bromoethyl)carbamate.

What is the InChI for (2-Bromo-ethyl)-carbamic acid benzyl ester?

The InChI is InChI=1S/C10H12BrNO2/c11-6-7-12-10(13)14-8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,12,13).

What is the InChIKey for (2-Bromo-ethyl)-carbamic acid benzyl ester?

The InChIKey is HREXFDIZSAUXBO-UHFFFAOYSA-N.

What is the canonical SMILES for (2-Bromo-ethyl)-carbamic acid benzyl ester?

The canonical SMILES is C1=CC=C(C=C1)COC(=O)NCCBr.

What is the CAS number for (2-Bromo-ethyl)-carbamic acid benzyl ester?

The CAS number is 53844-02-3.

What is the XLogP3 value for (2-Bromo-ethyl)-carbamic acid benzyl ester?

The XLogP3 value is 2.4.

How many hydrogen bond donor counts are in (2-Bromo-ethyl)-carbamic acid benzyl ester?

There is 1 hydrogen bond donor count.

Is the compound canonicalized for (2-Bromo-ethyl)-carbamic acid benzyl ester?

Yes, the compound is canonicalized.