2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride

CAS

529512-78-5

Catalog Number

ACM529512785-1

Category

Bromine Series

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The molecular formula of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is C7H7BrClF3N2.

What is the molecular weight of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The molecular weight of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is 291.49 g/mol.

What is the IUPAC name of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The IUPAC name of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is [2-bromo-5-(trifluoromethyl)phenyl]hydrazine;hydrochloride.

What is the InChI of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The InChI of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is InChI=1S/C7H6BrF3N2.ClH/c8-5-2-1-4(7(9,10)11)3-6(5)13-12;/h1-3,13H,12H2;1H.

What is the InChIKey of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The InChIKey of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is QAEDGRVAFKSCMX-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The canonical SMILES of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is C1=CC(=C(C=C1C(F)(F)F)NN)Br.Cl.

What is the CAS number of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The CAS number of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is 529512-78-5.

What is the hydrogen bond donor count of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The hydrogen bond donor count of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is 3.

What is the hydrogen bond acceptor count of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The hydrogen bond acceptor count of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is 5.

What is the topological polar surface area of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride?

The topological polar surface area of 2-Bromo-5-(trifluoromethyl)phenylhydrazine hydrochloride is 38Å².

Upstream Synthesis Route 1

739361-61-6

529512-78-5

Reference: [1]Hernandez, Susana; Moreno, Isabel; SanMartin, Raul; Gomez, German; Herrero, Maria Teresa; Dominguez, Esther
[Journal of Organic Chemistry, 2010, vol. 75, # 2, p. 434 - 441]