2-Bromo-4-(trifluoromethyl)benzonitrile

• CAS: 35764-15-9
• Catalog Number: ACM35764159
• Category: Bromine Series

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C8H3BrF3N.

What is the molecular weight of the compound?

The molecular weight of the compound is 250.01 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-bromo-4-(trifluoromethyl)benzonitrile.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C8H3BrF3N/c9-7-3-6(8(10,11)12)2-1-5(7)4-13/h1-3H.

What is the InChIKey of the compound?

The InChIKey of the compound is YQDJZASWOJHHGY-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=CC(=C(C=C1C(F)(F)F)Br)C#N.

What is the CAS number of the compound?

The CAS number of the compound is 35764-15-9.

What is the European Community (EC) number of the compound?

The European Community (EC) number of the compound is 252-715-4.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 3.2.

Is the compound Canonicalized?

Yes, the compound is canonicalized.