2-Bromo-4-nitropyridine-N-oxide

• CAS: 52092-43-0
• Catalog Number: ACM52092430
• Category: Bromine Series
• Molecular Weight: 218.99
• Molecular Formula: C₅H₃BrN₂O₃

Custom Q&A

What is the molecular formula of 2-Bromo-4-nitropyridine-N-oxide?

The molecular formula is C5H3BrN2O3.

What is the molecular weight of 2-Bromo-4-nitropyridine-N-oxide?

The molecular weight is 218.99 g/mol.

What is the IUPAC name of 2-Bromo-4-nitropyridine-N-oxide?

The IUPAC name is 2-bromo-4-nitro-1-oxidopyridin-1-ium.

What is the InChI of 2-Bromo-4-nitropyridine-N-oxide?

The InChI is InChI=1S/C5H3BrN2O3/c6-5-3-4(8(10)11)1-2-7(5)9/h1-3H.

What is the InChIKey of 2-Bromo-4-nitropyridine-N-oxide?

The InChIKey is IRBDHXCXCSFNEQ-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-4-nitropyridine-N-oxide?

The canonical SMILES is C1=C[N+](=C(C=C1[N+](=O)[O-])Br)[O-].

What is the CAS number of 2-Bromo-4-nitropyridine-N-oxide?

The CAS number is 52092-43-0.

What is the EC number of 2-Bromo-4-nitropyridine-N-oxide?

The EC number is 661-534-3.

What is the DSSTox Substance ID of 2-Bromo-4-nitropyridine-N-oxide?

The DSSTox Substance ID is DTXSID00397866.

What is the molecular weight of 2-Bromo-4-nitropyridine-N-oxide according to PubChem?

The molecular weight is 218.99 g/mol (computed by PubChem).