What is the molecular formula of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The molecular formula is C7H3BrClF3.
What is the molecular weight of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The molecular weight is 259.45 g/mol.
What are some synonyms for 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
Some synonyms include 2-Bromo-4-chlorobenzotrifluoride and 2-bromo-4-chloro-1-(trifluoromethyl)benzene.
What is the IUPAC name of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The IUPAC name is 2-bromo-4-chloro-1-(trifluoromethyl)benzene.
What is the InChI key of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The InChI key is ZIPJFBGICWZITF-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The canonical SMILES representation is C1=CC(=C(C=C1Cl)Br)C(F)(F)F.
How many hydrogen bond acceptors does 2-Bromo-4-chloro-1-(trifluoromethyl)benzene have?
It has 3 hydrogen bond acceptors.
What is the topological polar surface area of 2-Bromo-4-chloro-1-(trifluoromethyl)benzene?
The topological polar surface area is 0Ų.
Does 2-Bromo-4-chloro-1-(trifluoromethyl)benzene have any defined atom or bond stereocenters?
No, it does not have any defined atom or bond stereocenters.
Is the compound canonicalized?
Yes, the compound is canonicalized.