What is the molecular formula of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The molecular formula is C6H2BrClF3N.
What is the molecular weight of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The molecular weight is 260.44 g/mol.
What is the IUPAC name of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The IUPAC name is 2-bromo-3-chloro-5-(trifluoromethyl)pyridine.
What is the InChI of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The InChI is InChI=1S/C6H2BrClF3N/c7-5-4(8)1-3(2-12-5)6(9,10)11/h1-2H.
What is the InChIKey of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The InChIKey is SMTKGMYGLYWNDL-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The canonical SMILES is C1=C(C=NC(=C1Cl)Br)C(F)(F)F.
What is the CAS number of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The CAS number is 75806-84-7.
What is the European Community (EC) number of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The European Community (EC) number is 680-932-8.
What is the DSSTox Substance ID of 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine?
The DSSTox Substance ID is DTXSID40371226.
Is 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine a canonicalized compound?
Yes, 2-Bromo-3-chloro-5-(trifluoromethyl)pyridine is a canonicalized compound.