CAS
13466-43-8 Purity
98%
13466-43-8 Purity
98%
Inquiry Basket
2-Bromo-1-fluoro-4-nitrobenzene
CAS
701-45-1
Catalog Number
ACM701451
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the chemical formula of 2-Bromo-1-fluoro-4-nitrobenzene?
The chemical formula of 2-Bromo-1-fluoro-4-nitrobenzene is C6H3BrFNO2.
What is the molecular weight of 2-Bromo-1-fluoro-4-nitrobenzene?
The molecular weight of 2-Bromo-1-fluoro-4-nitrobenzene is 220.00 g/mol.
What is the IUPAC name of 2-Bromo-1-fluoro-4-nitrobenzene?
The IUPAC name of 2-Bromo-1-fluoro-4-nitrobenzene is 2-bromo-1-fluoro-4-nitrobenzene.
What is the InChI of 2-Bromo-1-fluoro-4-nitrobenzene?
The InChI of 2-Bromo-1-fluoro-4-nitrobenzene is InChI=1S/C6H3BrFNO2/c7-5-3-4(9(10)11)1-2-6(5)8/h1-3H.
What is the InChIKey of 2-Bromo-1-fluoro-4-nitrobenzene?
The InChIKey of 2-Bromo-1-fluoro-4-nitrobenzene is FAWMTDSAMOCUAR-UHFFFAOYSA-N.
What is the CAS number of 2-Bromo-1-fluoro-4-nitrobenzene?
The CAS number of 2-Bromo-1-fluoro-4-nitrobenzene is 701-45-1.
What is the XLogP3-AA value of 2-Bromo-1-fluoro-4-nitrobenzene?
The XLogP3-AA value of 2-Bromo-1-fluoro-4-nitrobenzene is 2.5.
How many hydrogen bond donor atoms are there in 2-Bromo-1-fluoro-4-nitrobenzene?
There are 0 hydrogen bond donor atoms in 2-Bromo-1-fluoro-4-nitrobenzene.
How many hydrogen bond acceptor atoms are there in 2-Bromo-1-fluoro-4-nitrobenzene?
There are 3 hydrogen bond acceptor atoms in 2-Bromo-1-fluoro-4-nitrobenzene.
Recommended Products
