2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone

• CAS: 1246471-30-6
• Catalog Number: ACM1246471306
• Category: Other Products

Custom Q&A

What is the molecular formula of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The molecular formula is C10H10Br2O.

What is the molecular weight of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The molecular weight is 305.99 g/mol.

What is the IUPAC name of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The IUPAC name is 2-bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone.

What is the InChI of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The InChI is InChI=1S/C10H10Br2O/c1-6-3-7(2)10(8(12)4-6)9(13)5-11/h3-4H,5H2,1-2H3.

What is the InChIKey of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The InChIKey is XZTGWLXJXCOBJM-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The canonical SMILES is CC1=CC(=C(C(=C1)Br)C(=O)CBr)C.

What is the CAS number of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The CAS number is 1246471-30-6.

What is the XLogP3-AA value of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?

The XLogP3-AA value is 3.8.

How many hydrogen bond donor counts does 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone have?

It has 1 hydrogen bond acceptor count.