2-Amino-5-bromothiazole-4-carboxylic acid methyl ester

• CAS: 850429-60-6
• Catalog Number: ACM850429606
• Category: Bromine Series
• Molecular Weight: 237.07
• Molecular Formula: C₅H₅N₂O₂BrS

Custom Q&A

What is the molecular formula of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The molecular formula is C5H5BrN2O2S.

What are the synonyms of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The synonyms are Methyl 2-amino-5-bromothiazole-4-carboxylate, 850429-60-6, methyl 2-amino-5-bromo-1,3-thiazole-4-carboxylate, 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester, MFCD00137990.

What is the molecular weight of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The molecular weight is 237.08 g/mol.

What is the IUPAC name of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The IUPAC name is methyl 2-amino-5-bromo-1,3-thiazole-4-carboxylate.

What is the InChI of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The InChI is InChI=1S/C5H5BrN2O2S/c1-10-4(9)2-3(6)11-5(7)8-2/h1H3,(H2,7,8).

What is the InChIKey of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The InChIKey is KVUHCAXYWHQFLW-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The canonical SMILES is COC(=O)C1=C(SC(=N1)N)Br.

What is the CAS number of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The CAS number is 850429-60-6.

What is the European Community (EC) number of 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester?

The European Community (EC) number is 690-838-9.

Is 2-Amino-5-bromothiazole-4-carboxylic acid methyl ester a canonicalized compound?

Yes, it is a canonicalized compound.