2-Amino-3-bromo-5-nitropyridine

• CAS: 15862-31-4
• Catalog Number: ACM15862314
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 2-Amino-3-bromo-5-nitropyridine?

The molecular formula of 2-Amino-3-bromo-5-nitropyridine is C5H4BrN3O2.

What is the molecular weight of 2-Amino-3-bromo-5-nitropyridine?

The molecular weight of 2-Amino-3-bromo-5-nitropyridine is 218.01 g/mol.

What is the IUPAC name of 2-Amino-3-bromo-5-nitropyridine?

The IUPAC name of 2-Amino-3-bromo-5-nitropyridine is 3-bromo-5-nitropyridin-2-amine.

What is the InChI of 2-Amino-3-bromo-5-nitropyridine?

The InChI of 2-Amino-3-bromo-5-nitropyridine is InChI=1S/C5H4BrN3O2/c6-4-1-3(9(10)11)2-8-5(4)7/h1-2H,(H2,7,8).

What is the InChIKey of 2-Amino-3-bromo-5-nitropyridine?

The InChIKey of 2-Amino-3-bromo-5-nitropyridine is OFXNHXMPRZDIDM-UHFFFAOYSA-N.

What is the canonical SMILES of 2-Amino-3-bromo-5-nitropyridine?

The canonical SMILES of 2-Amino-3-bromo-5-nitropyridine is C1=C(C=NC(=C1Br)N)[N+](=O)[O-].

What is the CAS number of 2-Amino-3-bromo-5-nitropyridine?

The CAS number of 2-Amino-3-bromo-5-nitropyridine is 15862-31-4.

What is the XLogP3-AA value of 2-Amino-3-bromo-5-nitropyridine?

The XLogP3-AA value of 2-Amino-3-bromo-5-nitropyridine is 1.

How many hydrogen bond donor counts are in 2-Amino-3-bromo-5-nitropyridine?

There is 1 hydrogen bond donor count in 2-Amino-3-bromo-5-nitropyridine.

How many hydrogen bond acceptor counts are in 2-Amino-3-bromo-5-nitropyridine?

There are 4 hydrogen bond acceptor counts in 2-Amino-3-bromo-5-nitropyridine.