175796-50-6 Purity
>98 %
If you have any other questions or need other size, please get a quote.
Specification
The CAS number is 175845-21-3.
CC(C)N1CCN2CCN(P1N(CC2)C(C)C)C(C)C
There are 4 hydrogen bond acceptors.
The XLogP3 value is 2.6.
The molecular weight is 300.42 g/mol.
The IUPAC name is 2,8,9-tri(propan-2-yl)-2,5,8,9-tetraza-1-phosphabicyclo[3.3.3]undecane.
The Monoisotopic Mass is 300.24428407.
DFRWCJYSXGNOFD-UHFFFAOYSA-N
There are 20 heavy atoms.
Some synonyms include AKOS015912888, CS-0108401, and 2,8,9-triisopropyl-2,5,8,9-tetraaza-1-phosphabicyclo[3.3.3]undecane.