1217501-12-6 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 2,6-Dichloro-3-formylphenylboronic acid is C7H5BCl2O3.
The molecular weight of 2,6-Dichloro-3-formylphenylboronic acid is 218.83 g/mol.
The IUPAC name of 2,6-Dichloro-3-formylphenylboronic acid is (2,6-dichloro-3-formylphenyl)boronic acid.
The CAS number of 2,6-Dichloro-3-formylphenylboronic acid is 1218790-87-4.
The InChI of 2,6-Dichloro-3-formylphenylboronic acid is InChI=1S/C7H5BCl2O3/c9-5-2-1-4(3-11)7(10)6(5)8(12)13/h1-3,12-13H.
The InChIKey of 2,6-Dichloro-3-formylphenylboronic acid is RZQRUQWEJZRMKR-UHFFFAOYSA-N.
The canonical SMILES of 2,6-Dichloro-3-formylphenylboronic acid is B(C1=C(C=CC(=C1Cl)C=O)Cl)(O)O.
The hydrogen bond donor count of 2,6-Dichloro-3-formylphenylboronic acid is 2.
The hydrogen bond acceptor count of 2,6-Dichloro-3-formylphenylboronic acid is 3.
The topological polar surface area of 2,6-Dichloro-3-formylphenylboronic acid is 57.5Ų.