2,5-Dimethylpyridine-3-boronicacidpinacolester

• CAS: 1309980-12-8
• Catalog Number: ACM1309980128
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The molecular formula is C13H20BNO2.

What is the molecular weight of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The molecular weight is 233.12 g/mol.

What is the IUPAC name of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The IUPAC name is 2,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.

What is the InChI of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The InChI is InChI=1S/C13H20BNO2/c1-9-7-11(10(2)15-8-9)14-16-12(3,4)13(5,6)17-14/h7-8H,1-6H3.

What is the InChIKey of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The InChIKey is YBBSPCPDRHRFBS-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2C).

What is the CAS number of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The CAS number is 1309980-12-8.

What is the EC number of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The EC number is 849-124-4.

What is the DSSTox Substance ID of 2,5-Dimethylpyridine-3-boronic acid pinacol ester?

The DSSTox Substance ID is DTXSID10694419.

Is 2,5-Dimethylpyridine-3-boronic acid pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.