2,5-Difluoro-4-methoxyphenylboronic acid

• CAS: 897958-93-9
• Catalog Number: ACM897958939
• Category: Other Products; Boronic Acids
• Molecular Weight: 187.94
• Molecular Formula: C₇H₇BF₂O₃

Custom Q&A

What is the molecular formula of 2,5-Difluoro-4-methoxyphenylboronic acid?

The molecular formula of 2,5-Difluoro-4-methoxyphenylboronic acid is C7H7BF2O3.

What is the molecular weight of 2,5-Difluoro-4-methoxyphenylboronic acid?

The molecular weight of 2,5-Difluoro-4-methoxyphenylboronic acid is 187.94 g/mol.

What is the IUPAC name of 2,5-Difluoro-4-methoxyphenylboronic acid?

The IUPAC name of 2,5-Difluoro-4-methoxyphenylboronic acid is (2,5-difluoro-4-methoxyphenyl)boronic acid.

What is the InChI of 2,5-Difluoro-4-methoxyphenylboronic acid?

The InChI of 2,5-Difluoro-4-methoxyphenylboronic acid is InChI=1S/C7H7BF2O3/c1-13-7-3-5(9)4(8(11)12)2-6(7)10/h2-3,11-12H,1H3.

What is the InChIKey of 2,5-Difluoro-4-methoxyphenylboronic acid?

The InChIKey of 2,5-Difluoro-4-methoxyphenylboronic acid is BRMUXDWCSVTVPQ-UHFFFAOYSA-N.

What is the canonical SMILES of 2,5-Difluoro-4-methoxyphenylboronic acid?

The canonical SMILES of 2,5-Difluoro-4-methoxyphenylboronic acid is B(C1=CC(=C(C=C1F)OC)F)(O)O.

What is the CAS number of 2,5-Difluoro-4-methoxyphenylboronic acid?

The CAS number of 2,5-Difluoro-4-methoxyphenylboronic acid is 897958-93-9.

What is the hydrogen bond donor count of 2,5-Difluoro-4-methoxyphenylboronic acid?

The hydrogen bond donor count of 2,5-Difluoro-4-methoxyphenylboronic acid is 2.

What is the hydrogen bond acceptor count of 2,5-Difluoro-4-methoxyphenylboronic acid?

The hydrogen bond acceptor count of 2,5-Difluoro-4-methoxyphenylboronic acid is 5.

Is 2,5-Difluoro-4-methoxyphenylboronic acid a canonicalized compound?

Yes, 2,5-Difluoro-4-methoxyphenylboronic acid is a canonicalized compound.