2-(3-Trimethoxysilylpropylthio)Thiophene

• CAS: 1364140-50-0
• Catalog Number: ACM1364140500
• Category: Siloxanes
• Molecular Weight: 278.46 g/mol
• Molecular Formula: C10H18O3S2Si
• Appearance: Transparent liquid
• Packaging: 10 g; 100 g

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H18O3S2Si.

What are the synonyms of the compound?

The synonyms of the compound are 1364140-50-0, 2-(3-TRIMETHOXYSILYLPROPYLTHIO)THIOPHENE, 2-Thienyl[3-(trimethoxysilyl)propyl] sulfide, Trimethoxy(3-(thiophen-2-ylthio)propyl)silane, and trimethoxy(3-thiophen-2-ylsulfanylpropyl)silane.

What is the molecular weight of the compound?

The molecular weight of the compound is 278.5 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is trimethoxy(3-thiophen-2-ylsulfanylpropyl)silane.

What is the InChI code of the compound?

The InChI code of the compound is InChI=1S/C10H18O3S2Si/c1-11-16(12-2,13-3)9-5-8-15-10-6-4-7-14-10/h4,6-7H,5,8-9H2,1-3H3.

What is the InChIKey of the compound?

The InChIKey of the compound is IEALAANSRUPKOC-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CO[Si](CCCSC1=CC=CS1)(OC)OC.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 8 rotatable bond counts.