CAS
1029654-29-2 Purity
---
1029654-29-2 Purity
---
Inquiry Basket
2,3-Dichloropyridine-5-boronicacid
CAS
1072944-15-0
Catalog Number
ACM1072944150-1
Category
Boro-Amino Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,3-Dichloropyridine-5-boronic acid?
The molecular formula of 2,3-Dichloropyridine-5-boronic acid is C5H4BCl2NO2.
What is the synonym for 2,3-Dichloropyridine-5-boronic acid?
The synonym for 2,3-Dichloropyridine-5-boronic acid is (5,6-Dichloropyridin-3-yl)boronic acid.
What is the molecular weight of 2,3-Dichloropyridine-5-boronic acid?
The molecular weight of 2,3-Dichloropyridine-5-boronic acid is 191.81 g/mol.
What is the IUPAC name of 2,3-Dichloropyridine-5-boronic acid?
The IUPAC name of 2,3-Dichloropyridine-5-boronic acid is (5,6-dichloropyridin-3-yl)boronic acid.
What is the InChI of 2,3-Dichloropyridine-5-boronic acid?
The InChI of 2,3-Dichloropyridine-5-boronic acid is InChI=1S/C5H4BCl2NO2/c7-4-1-3(6(10)11)2-9-5(4)8/h1-2,10-11H.
What is the InChIKey of 2,3-Dichloropyridine-5-boronic acid?
The InChIKey of 2,3-Dichloropyridine-5-boronic acid is DRJYUOQTLCPXHE-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Dichloropyridine-5-boronic acid?
The canonical SMILES of 2,3-Dichloropyridine-5-boronic acid is B(C1=CC(=C(N=C1)Cl)Cl)(O)O.
What is the CAS number of 2,3-Dichloropyridine-5-boronic acid?
The CAS number of 2,3-Dichloropyridine-5-boronic acid is 1072944-15-0.
What is the EC number of 2,3-Dichloropyridine-5-boronic acid?
The EC number of 2,3-Dichloropyridine-5-boronic acid is 870-401-0.
Recommended Products
