1H-Indole-2-carboxylic acid, methyl ester

CAS

1202-04-6

Catalog Number

ACM1202046

Category

Indoles

Molecular Weight

175.19

Molecular Formula

C10H9NO2

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

1H-Indole-2-carboxylicacid, methyl ester;Indole-2-carboxylic acid, methyl ester (6CI,7CI,8CI);2-(Methoxycarbonyl)indole;Methyl 1H-indole-2-carboxylate;Methyl 2-indolecarboxylate;NSC 78006

Boiling Point

331.7 °C at 760 mmHg

Melting Point

151-153 °C

Density

1.253 g/cm³

Appearance

Off white crystals

What is the molecular formula of 1H-Indole-2-carboxylic acid, methyl ester?

The molecular formula of 1H-Indole-2-carboxylic acid, methyl ester is C10H9NO2.

What is the molecular weight of 1H-Indole-2-carboxylic acid, methyl ester?

The molecular weight of 1H-Indole-2-carboxylic acid, methyl ester is 175.18 g/mol.

What is the IUPAC name of 1H-Indole-2-carboxylic acid, methyl ester?

The IUPAC name of 1H-Indole-2-carboxylic acid, methyl ester is methyl 1H-indole-2-carboxylate.

What is the InChI of 1H-Indole-2-carboxylic acid, methyl ester?

The InChI of 1H-Indole-2-carboxylic acid, methyl ester is InChI=1S/C10H9NO2/c1-13-10(12)9-6-7-4-2-3-5-8(7)11-9/h2-6,11H,1H3.

What is the InChIKey of 1H-Indole-2-carboxylic acid, methyl ester?

The InChIKey of 1H-Indole-2-carboxylic acid, methyl ester is NQPIEWBAWBFGOB-UHFFFAOYSA-N.

What is the canonical SMILES of 1H-Indole-2-carboxylic acid, methyl ester?

The canonical SMILES of 1H-Indole-2-carboxylic acid, methyl ester is COC(=O)C1=CC2=CC=CC=C2N1.

What is the CAS number of 1H-Indole-2-carboxylic acid, methyl ester?

The CAS number of 1H-Indole-2-carboxylic acid, methyl ester is 1202-04-6.

What is the XLogP3 value of 1H-Indole-2-carboxylic acid, methyl ester?

The XLogP3 value of 1H-Indole-2-carboxylic acid, methyl ester is 2.5.

How many hydrogen bond donor counts does 1H-Indole-2-carboxylic acid, methyl ester have?

1H-Indole-2-carboxylic acid, methyl ester has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 1H-Indole-2-carboxylic acid, methyl ester have?

1H-Indole-2-carboxylic acid, methyl ester has 2 hydrogen bond acceptor counts.