56050-04-5 Purity
95%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 18-hydroxycorticosterone is C21H30O5.
The molecular weight of 18-hydroxycorticosterone is 362.5 g/mol.
A synonym for 18-hydroxycorticosterone is 18-HYDROXYCORTICOSTERONE.
It is mentioned that 18-hydroxycorticosterone has a role as a human metabolite and a mouse metabolite.
18-hydroxycorticosterone is functionally related to corticosterone.
The IUPAC name is (8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-13-(hydroxymethyl)-10-methyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one.
The Canonical SMILES is CC12CCC(=O)C=C1CCC3C2C(CC4(C3CCC4C(=O)CO)CO)O.
Some identifiers include CAS number 561-65-9, UNII 4U5T0O9SI3, and KEGG ID C01124.
The XLogP3 value is 0.7.
The hydrogen bond donor count is 3.