701-35-9 Purity
0.97
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is trichloro(11-chloroundecyl)silane.
The molecular formula of the compound is C11H22Cl4Si.
The molecular weight of the compound is 324.2 g/mol.
The InChI of the compound is InChI=1S/C11H22Cl4Si/c12-10-8-6-4-2-1-3-5-7-9-11-16(13,14)15/h1-11H2.
The InChIKey of the compound is AISIWSXYGRYXLI-UHFFFAOYSA-N.
The canonical SMILES of the compound is C(CCCCC[Si](Cl)(Cl)Cl)CCCCCCl.
The compound has 0 hydrogen bond donor count.
The compound has 0 hydrogen bond acceptor count.
The compound has 10 rotatable bond count.
The topological polar surface area of the compound is 0Ų.