31410-07-8 Purity
≥97.0%
If you have any other questions or need other size, please get a quote.
The molecular formula is C8H13ClN2O2.
The molecular weight is 204.65 g/mol.
Some synonyms include 1-(2-ethoxy-2-oxoethyl)-3-methyl-1H-imidazol-3-ium chloride and ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;chloride.
The IUPAC name is ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate;chloride.
The InChI is InChI=1S/C8H13N2O2.ClH/c1-3-12-8(11)6-10-5-4-9(2)7-10;/h4-5,7H,3,6H2,1-2H3;1H/q+1;/p-1.
It has 0 hydrogen bond donor counts.
It has 4 rotatable bond counts.
The exact mass is 204.0665554 g/mol.
The topological polar surface area is 35.1 Ų.
Yes, the compound is canonicalized.