1-Bromo-4-(difluoromethyl)-2-fluorobenzene

• CAS: 1214386-70-5
• Catalog Number: ACM1214386705
• Category: Alcohols
• Molecular Weight: 225.01
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The molecular formula of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is C7H4BrF3.

What is the molecular weight of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The molecular weight of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is 225.01 g/mol.

What is the IUPAC name of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The IUPAC name of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is 1-bromo-4-(difluoromethyl)-2-fluorobenzene.

What is the InChI of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The InChI of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is InChI=1S/C7H4BrF3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,7H.

What is the InChIKey of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The InChIKey of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is TVFLYOWMGULWTE-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The canonical SMILES of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is C1=CC(=C(C=C1C(F)F)F)Br.

How many hydrogen bond donor counts does 1-Bromo-4-(difluoromethyl)-2-fluorobenzene have?

1-Bromo-4-(difluoromethyl)-2-fluorobenzene has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 1-Bromo-4-(difluoromethyl)-2-fluorobenzene have?

1-Bromo-4-(difluoromethyl)-2-fluorobenzene has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 1-Bromo-4-(difluoromethyl)-2-fluorobenzene have?

1-Bromo-4-(difluoromethyl)-2-fluorobenzene has 1 rotatable bond count.

What is the topological polar surface area of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene?

The topological polar surface area of 1-Bromo-4-(difluoromethyl)-2-fluorobenzene is 0Ų.