1-Bromo-2-fluoro-4-(methylsulfonyl)benzene

• CAS: 1032825-02-7
• Catalog Number: ACM1032825027
• Category: Other Products; Bromine Series
• Molecular Formula: C₇H₆BrFO₂S

Custom Reviews

May 23, 2023

---

Work well in organic synthesis.
In experiments, 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene is often used as an organic intermediate to synthesize various organic compounds.

Custom Q&A

What is the molecular formula of the compound 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The molecular formula of the compound is C7H6BrFO2S.

What is the molecular weight of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The molecular weight of the compound is 253.09 g/mol.

What is the IUPAC name of the compound 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The IUPAC name of the compound is 1-bromo-2-fluoro-4-methylsulfonylbenzene.

What is the InChI of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The InChI of the compound is InChI=1S/C7H6BrFO2S/c1-12(10,11)5-2-3-6(8)7(9)4-5/h2-4H,1H3.

What is the InChIKey of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The InChIKey of the compound is QALKAUDOPSIGEI-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The canonical SMILES of the compound is CS(=O)(=O)C1=CC(=C(C=C1)Br)F.

What is the CAS number of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The CAS number of the compound is 1032825-02-7.

What is the European Community (EC) number of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The European Community (EC) number of the compound is 816-266-3.

What is the PubChem compound ID of 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The PubChem compound ID of the compound is 46738908.

What is the molecular weight computed by PubChem for 1-Bromo-2-fluoro-4-(methylsulfonyl)benzene?

The molecular weight computed by PubChem for the compound is 253.09 g/mol.