1-benzyl-2,3-methylimidazolium bromide

• CAS: 862999-80-2
• Catalog Number: ACM862999802
• Category: Functionized Ionic Liquids
• Molecular Weight: 267.165
• Molecular Formula: C12H15BrN2
• Application: Metal Plating, Electropolishing, Metal Reprocessing, Phase transfer media, Batteries Fuel Cells, Nanomaterials, Industrial Solvents, Nuclear Fuel Red Waste, Enzymatic Catalysis, Lubricants Heat Transfer and Solar Energy Conversion.
• Abbreviation: BzDMIMBr
• Chemical Formula: BzDMIMBr

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C12H17BrN2.

What is the molecular weight of the compound?

The molecular weight of the compound is 269.18 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 3-benzyl-1,2-dimethyl-1,2-dihydroimidazol-1-ium;bromide.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C12H16N2.BrH/c1-11-13(2)8-9-14(11)10-12-6-4-3-5-7-12;/h3-9,11H,10H2,1-2H3;1H.

What is the InChIKey of the compound?

The InChIKey of the compound is NCRREXXQJSLTJY-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1[NH+](C=CN1CC2=CC=CC=C2)C.[Br-].

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 2 rotatable bond counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.