1-(5-BROMO-2-FLUOROPHENYL)PROPAN-1-ONE

• CAS: 864774-65-2
• Catalog Number: ACM864774652
• Category: Other Products; Bromine Series
• Molecular Formula: C9H8BrFO

Custom Reviews

May 23, 2023

---

An organic intermediate.
1-(5-BROMO-2-FLUOROPHENYL)PROPAN-1-ONE can form carbazole heterocyclic compounds with nitrogen compounds.

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C9H8BrFO.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 1-(5-bromo-2-fluorophenyl)propan-1-one.

What is the molecular weight of the compound?

The molecular weight of the compound is 231.06 g/mol.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C9H8BrFO/c1-2-9(12)7-5-6(10)3-4-8(7)11/h3-5H,2H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is ZTNPZJQLIBWJDY-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCC(=O)C1=C(C=CC(=C1)Br)F.

What is the CAS number of the compound?

The CAS number of the compound is 864774-65-2.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 2.9.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 0.

Is the compound canonicalized?

Yes, the compound is canonicalized according to PubChem.