What is the molecular formula of (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The molecular formula is C27H26Cl2P2Pd.
What is the molecular weight of (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The molecular weight is 589.8 g/mol.
What are the synonyms for (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
Synonyms include 59831-02-6, Dichloro[1,3-bis(diphenylphosphino)propane]palladium(II), and more.
When was (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride created and modified according to the reference?
It was created on 2006-10-26 and modified on 2023-12-30.
What is the IUPAC name of (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The IUPAC name is dichloropalladium;3-diphenylphosphanylpropyl(diphenyl)phosphane.
What is the Canonical SMILES notation for (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The Canonical SMILES notation is C1=CC=C(C=C1)P(CCCP(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4.Cl[Pd]Cl.
What is the InChIKey for (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The InChIKey is LDFBXJODFADZBN-UHFFFAOYSA-L.
What is the European Community (EC) Number for (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The EC Number is 627-387-4.
What is the Hydrogen Bond Donor Count of (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
The Hydrogen Bond Donor Count is 0.
Is the Compound Is Canonicalized according to the reference for (1,3-Bis(diphenylphosphino)propane)palladium(II) chloride?
Yes, the compound is canonicalized.