1,1,1,5,5,5-Hexaethyl-3-Methyltrisiloxane

• CAS: 13716-38-6
• Catalog Number: ACM13716386
• Category: Siloxanes
• Molecular Weight: 306.67 g/mol
• Molecular Formula: C13H34O2Si3
• Appearance: Transparent liquid
• Packaging: 10 g; 100 g

Custom Q&A

What is the molecular formula of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The molecular formula of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is C13H33O2Si3.

What is the molecular weight of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The molecular weight of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is 305.65 g/mol.

What is the InChI of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The InChI of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is InChI=1S/C13H33O2Si3/c1-8-17(9-2,10-3)14-16(7)15-18(11-4,12-5)13-6/h8-13H2,1-7H3.

What is the InChIKey of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The InChIKey of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is DGJHPIHKEDLELD-UHFFFAOYSA-N.

What is the canonical SMILES of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The canonical SMILES of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is CC[Si](CC)(CC)O[Si](C)O[Si](CC)(CC)CC.

What is the hydrogen bond donor count of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The hydrogen bond donor count of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is 0.

What is the hydrogen bond acceptor count of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The hydrogen bond acceptor count of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is 2.

How many rotatable bonds does 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane have?

1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane has 10 rotatable bonds.

What is the exact mass of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane?

The exact mass of 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is 305.17883489 g/mol.

Is 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane a canonicalized compound?

Yes, 1,1,1,5,5,5-Hexaethyl-3-methyltrisiloxane is a canonicalized compound.