What is the molecular formula of trimethylsilylmethyltrifluoromethanesulfonate?
The molecular formula is C5H11F3O3SSi.
What is the molecular weight of trimethylsilylmethyltrifluoromethanesulfonate?
The molecular weight is 236.29 g/mol.
What is the IUPAC name of trimethylsilylmethyltrifluoromethanesulfonate?
The IUPAC name is trimethylsilylmethyl trifluoromethanesulfonate.
What is the InChI of trimethylsilylmethyltrifluoromethanesulfonate?
The InChI is InChI=1S/C5H11F3O3SSi/c1-13(2,3)4-11-12(9,10)5(6,7)8/h4H2,1-3H3.
What is the InChIKey of trimethylsilylmethyltrifluoromethanesulfonate?
The InChIKey is VMDMAAJZSXXCQV-UHFFFAOYSA-N.
What is the canonical SMILES of trimethylsilylmethyltrifluoromethanesulfonate?
The canonical SMILES is C[Si](C)(C)COS(=O)(=O)C(F)(F)F.
What is the CAS number of trimethylsilylmethyltrifluoromethanesulfonate?
The CAS number is 64035-64-9.
What is the European Community (EC) number of trimethylsilylmethyltrifluoromethanesulfonate?
The European Community (EC) number is 628-446-7.
What is the DSSTox Substance ID of trimethylsilylmethyltrifluoromethanesulfonate?
The DSSTox Substance ID is DTXSID00375381.
Is trimethylsilylmethyltrifluoromethanesulfonate a canonicalized compound?
Yes, trimethylsilylmethyltrifluoromethanesulfonate is a canonicalized compound.