Potassium 5-methoxypyridine-3-trifluoroborate

• CAS: 1451390-69-4
• Catalog Number: ACM1451390694
• Category: Borate

Custom Q&A

What is the molecular formula of Potassium 5-methoxypyridine-3-trifluoroborate?

The molecular formula of Potassium 5-methoxypyridine-3-trifluoroborate is C6H6BF3KNO.

What is the synonym for Potassium 5-methoxypyridine-3-trifluoroborate?

The synonym for Potassium 5-methoxypyridine-3-trifluoroborate is Potassium trifluoro(5-methoxypyridin-3-yl)borate.

What is the molecular weight of Potassium 5-methoxypyridine-3-trifluoroborate?

The molecular weight of Potassium 5-methoxypyridine-3-trifluoroborate is 215.02 g/mol.

What is the IUPAC name of Potassium 5-methoxypyridine-3-trifluoroborate?

The IUPAC name of Potassium 5-methoxypyridine-3-trifluoroborate is potassium;trifluoro-(5-methoxypyridin-3-yl)boranuide.

What is the InChI of Potassium 5-methoxypyridine-3-trifluoroborate?

The InChI of Potassium 5-methoxypyridine-3-trifluoroborate is InChI=1S/C6H6BF3NO.K/c1-12-6-2-5(3-11-4-6)7(8,9)10;/h2-4H,1H3;/q-1;+1.

What is the InChIKey of Potassium 5-methoxypyridine-3-trifluoroborate?

The InChIKey of Potassium 5-methoxypyridine-3-trifluoroborate is GONJJEODGCVTSI-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium 5-methoxypyridine-3-trifluoroborate?

The canonical SMILES of Potassium 5-methoxypyridine-3-trifluoroborate is [B-](C1=CC(=CN=C1)OC)(F)(F)F.[K+].

What is the hydrogen bond donor count of Potassium 5-methoxypyridine-3-trifluoroborate?

The hydrogen bond donor count of Potassium 5-methoxypyridine-3-trifluoroborate is 0.

What is the hydrogen bond acceptor count of Potassium 5-methoxypyridine-3-trifluoroborate?

The hydrogen bond acceptor count of Potassium 5-methoxypyridine-3-trifluoroborate is 6.

What is the topological polar surface area of Potassium 5-methoxypyridine-3-trifluoroborate?

The topological polar surface area of Potassium 5-methoxypyridine-3-trifluoroborate is 22.1Ų.