Potassium 4-methylphenyltrifluoroborate

• CAS: 216434-82-1
• Catalog Number: ACM216434821
• Category: Biomaterials
• Molecular Weight: 198.03
• Molecular Formula: C₇H₇BF₃K
• Synonyms: POTASSIUM 4-METHYLPHENYLTRIFLUOROBORATE;POTASSIUM P-TOLYLTRIFLUOROBORATE;Potassium p-tolytrifluoroborate;4-Methylphenyltrifluoroboric acid potassium salt~p-Tolyltrifluoroboric acid potassium salt;4-methylphenyltrifluoroboric acid potassium salt;p-tolyltri

Custom Q&A

What is the molecular formula of Potassium 4-methylphenyltrifluoroborate?

The molecular formula is C7H7BF3K.

What is the molecular weight of Potassium 4-methylphenyltrifluoroborate?

The molecular weight is 198.04 g/mol.

What is the IUPAC name of Potassium 4-methylphenyltrifluoroborate?

The IUPAC name is potassium;trifluoro-(4-methylphenyl)boranuide.

What is the InChI of Potassium 4-methylphenyltrifluoroborate?

The InChI is InChI=1S/C7H7BF3.K/c1-6-2-4-7(5-3-6)8(9,10)11;/h2-5H,1H3;/q-1;+1.

What is the InChIKey of Potassium 4-methylphenyltrifluoroborate?

The InChIKey is KRWDYXJWQBTBAH-UHFFFAOYSA-N.

What is the canonical SMILES of Potassium 4-methylphenyltrifluoroborate?

The canonical SMILES is [B-](C1=CC=C(C=C1)C)(F)(F)F.[K+].

What is the CAS number of Potassium 4-methylphenyltrifluoroborate?

The CAS number is 216434-82-1.

What is the European Community (EC) number of Potassium 4-methylphenyltrifluoroborate?

The EC number is 624-810-4.

How many hydrogen bond donor counts does Potassium 4-methylphenyltrifluoroborate have?

Potassium 4-methylphenyltrifluoroborate has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Potassium 4-methylphenyltrifluoroborate have?

Potassium 4-methylphenyltrifluoroborate has 4 hydrogen bond acceptor counts.