POTASSIUM (3-CYANOPHENYL)TRIFLUOROBORATE

• CAS: 850623-46-0
• Catalog Number: ACM850623460
• Category: Borate
• Molecular Weight: 209.02
• Molecular Formula: C₇H₄BF₃KN
• Synonyms: Potassium (3-Cyanophenyl)trifluoroborate, 850623-46-0, CTK8B3680, MolPort-001-772-375, ANW-42936, SBB094139, Potassium 3-cyanophenyltrifluoroborate, AKOS009159002, AB20522, PC11239, AK-50174, Potassium (3-cyanophenyl)trifluoroborate,, FT-0688829, P1814, potassium (3-cyanophenyl)-trifluoroboranuide, X2476, B-5078, potassium ion (3-cyanophenyl)trifluoroboranuide, A841160, potassium (3-cyanophenyl)-tris(fluoranyl)boranuide
• IUPAC Name: potassium;(3-cyanophenyl)-trifluoroboranuide
• Canonical SMILES: [B-](C1=CC(=CC=C1)C#N)(F)(F)F.[K+]
• InChI Key: STQLGUGARUCKLI-UHFFFAOYSA-N
• H-Bond Acceptor: 5
• H-Bond Donor: 0

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is potassium;(3-cyanophenyl)-trifluoroboranuide.

What is the molecular formula of the compound?

The molecular formula of the compound is C7H4BF3KN.

What is the molecular weight of the compound?

The molecular weight of the compound is 209.02 g/mol.

What is the CAS number of the compound?

The CAS number of the compound is 850623-46-0.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 5 hydrogen bond acceptor counts.

What is the exact mass of the compound?

The exact mass of the compound is 209.0025953 g/mol.

How many heavy atom counts does the compound have?

The compound has 13 heavy atom counts.

Does the compound have any defined atom stereocenters?

No, the compound does not have any defined atom stereocenters.

What is the covalently-bonded unit count of the compound?

The compound has a covalently-bonded unit count of 2.