Picene

• CAS: 213-46-7
• Catalog Number: ACM213467
• Category: Other Products
• Molecular Weight: 278.35
• Molecular Formula: C₂₂H₁₄
• Synonyms: 1,2,7,8-Dibenzphenanthrene;1,2:7,8-Dibenzophenanthrene;1,2:7,8-Dibenzphenanthrene;3,4-Benzchrysene;Benzo(a)chrysene;benzo[a]chrysene;beta,beta-Binaphthyleneethene;Dibenzo(a,i)phenanthrene

Custom Q&A

What is the PubChem CID for picene?

The PubChem CID for picene is 9162.

What is the molecular formula of picene?

The molecular formula of picene is C22H14.

What is the molecular weight of picene?

The molecular weight of picene is 278.3 g/mol.

How is picene obtained?

Picene is obtained during the distillation of petroleum.

What is the IUPAC name of picene?

The IUPAC name of picene is picene.

What is the InChI of picene?

The InChI of picene is InChI=1S/C22H14/c1-3-7-17-15(5-1)9-11-21-19(17)13-14-20-18-8-4-2-6-16(18)10-12-22(20)21/h1-14H.

What is the Canonical SMILES of picene?

The Canonical SMILES of picene is C1=CC=C2C(=C1)C=CC3=C2C=CC4=C3C=CC5=CC=CC=C54.

What is the CAS number for picene?

The CAS number for picene is 213-46-7.

How many hydrogen bond donor counts does picene have?

Picene has 0 hydrogen bond donor counts.

What is the topological polar surface area of picene?

The topological polar surface area of picene is 0-2.